C13H26O7 — CID 163504653
2-[2-[2-[2-(3-hydroxypentoxy)ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 163504653) has the molecular formula C13H26O7 and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-[2-[2-[2-(3-hydroxypentoxy)ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-(3-hydroxypentoxy)ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 163504653 |
| Molecular Formula | C13H26O7 |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-[2-[2-[2-(3-hydroxypentoxy)ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | CCC(O)CCOCCOCCOCCOCC(=O)O |
| InChI | InChI=1S/C13H26O7/c1-2-12(14)3-4-17-5-6-18-7-8-19-9-10-20-11-13(15)16/h12,14H,2-11H2,1H3,(H,15,16) |
| InChIKey | UBNIEGITLSYJKN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|