C9H18O4 — CID 112692943
2-[2-(3-methylbutoxy)ethoxy]acetic acid (PubChem CID 112692943) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-[2-(3-methylbutoxy)ethoxy]acetic acid.
| Compound Name | 2-[2-(3-methylbutoxy)ethoxy]acetic acid |
|---|---|
| PubChem CID | 112692943 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-[2-(3-methylbutoxy)ethoxy]acetic acid |
| SMILES | CC(C)CCOCCOCC(=O)O |
| InChI | InChI=1S/C9H18O4/c1-8(2)3-4-12-5-6-13-7-9(10)11/h8H,3-7H2,1-2H3,(H,10,11) |
| InChIKey | NMBIBYNOTFNVJS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|