C6H13NO4 — CID 19037384
2-[2-(1-aminoethoxy)ethoxy]acetic acid (PubChem CID 19037384) has the molecular formula C6H13NO4 and a molecular weight of 163.17 g/mol. Its IUPAC name is 2-[2-(1-aminoethoxy)ethoxy]acetic acid.
| Compound Name | 2-[2-(1-aminoethoxy)ethoxy]acetic acid |
|---|---|
| PubChem CID | 19037384 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 2-[2-(1-aminoethoxy)ethoxy]acetic acid |
| SMILES | CC(N)OCCOCC(=O)O |
| InChI | InChI=1S/C6H13NO4/c1-5(7)11-3-2-10-4-6(8)9/h5H,2-4,7H2,1H3,(H,8,9) |
| InChIKey | QHLAKRNULVMBPT-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|