2-(2-propanoyloxyethoxy)acetic acid

C7H12O5 — CID 171607283

IUPAC2-(2-propanoyloxyethoxy)acetic acid
SMILESCCC(=O)OCCOCC(=O)O
InChIInChI=1S/C7H12O5/c1-2-7(10)12-4-3-11-5-6(8)9/h2-5H2,1H3,(H,8,9)
InChIKeyBFEWWOKLLGRONI-UHFFFAOYSA-N
MW176.17 g/mol
LogP0.04
Rot. Bonds6

About 2-(2-propanoyloxyethoxy)acetic acid

2-(2-propanoyloxyethoxy)acetic acid (PubChem CID 171607283) has the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. Its IUPAC name is 2-(2-propanoyloxyethoxy)acetic acid.

Molecular Properties

Compound Name2-(2-propanoyloxyethoxy)acetic acid
PubChem CID171607283
Molecular FormulaC7H12O5
Molecular Weight176.17 g/mol
Exact Mass176.07
IUPAC Name2-(2-propanoyloxyethoxy)acetic acid
SMILESCCC(=O)OCCOCC(=O)O
InChIInChI=1S/C7H12O5/c1-2-7(10)12-4-3-11-5-6(8)9/h2-5H2,1H3,(H,8,9)
InChIKeyBFEWWOKLLGRONI-UHFFFAOYSA-N
XLogP0.04
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.17
LogP ≤ 50.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(2-propanoyloxyethoxy)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-propanoyloxyethoxy)acetic acid?
The IUPAC name of 2-(2-propanoyloxyethoxy)acetic acid (CID 171607283) is 2-(2-propanoyloxyethoxy)acetic acid.
What is the SMILES notation for 2-(2-propanoyloxyethoxy)acetic acid?
The canonical SMILES for 2-(2-propanoyloxyethoxy)acetic acid is CCC(=O)OCCOCC(=O)O.
What is the InChIKey of 2-(2-propanoyloxyethoxy)acetic acid?
The InChIKey is BFEWWOKLLGRONI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O5/c1-2-7(10)12-4-3-11-5-6(8)9/h2-5H2,1H3,(H,8,9).
What are the key properties of 2-(2-propanoyloxyethoxy)acetic acid?
2-(2-propanoyloxyethoxy)acetic acid has a molecular weight of 176.17 g/mol, XLogP of 0.04, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-propanoyloxyethoxy)acetic acid is sourced from PubChem (CID 171607283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).