C23H38O13 — CID 160907308
4-oxo-4-[2-[2-(4-oxopentanoyloxy)ethoxy]ethoxy]butanoic acid;2-(2-propanoyloxyethoxy)ethyl propanoate (PubChem CID 160907308) has the molecular formula C23H38O13 and a molecular weight of 522.54 g/mol. Its IUPAC name is 4-oxo-4-[2-[2-(4-oxopentanoyloxy)ethoxy]ethoxy]butanoic acid;2-(2-propanoyloxyethoxy)ethyl propanoate.
| Compound Name | 4-oxo-4-[2-[2-(4-oxopentanoyloxy)ethoxy]ethoxy]butanoic acid;2-(2-propanoyloxyethoxy)ethyl propanoate |
|---|---|
| PubChem CID | 160907308 |
| Molecular Formula | C23H38O13 |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 4-oxo-4-[2-[2-(4-oxopentanoyloxy)ethoxy]ethoxy]butanoic acid;2-(2-propanoyloxyethoxy)ethyl propanoate |
| SMILES | CC(=O)CCC(=O)OCCOCCOC(=O)CCC(=O)O.CCC(=O)OCCOCCOC(=O)CC |
| InChI | InChI=1S/C13H20O8.C10H18O5/c1-10(14)2-4-12(17)20-8-6-19-7-9-21-13(18)5-3-11(15)16;1-3-9(11)14-7-5-13-6-8-15-10(12)4-2/h2-9H2,1H3,(H,15,16);3-8H2,1-2H3 |
| InChIKey | SQHSKQKMESZCQB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|