C15H28O6 — CID 87460185
4-oxo-4-[4-(4-propoxybutoxy)butoxy]butanoic acid (PubChem CID 87460185) has the molecular formula C15H28O6 and a molecular weight of 304.38 g/mol. Its IUPAC name is 4-oxo-4-[4-(4-propoxybutoxy)butoxy]butanoic acid.
| Compound Name | 4-oxo-4-[4-(4-propoxybutoxy)butoxy]butanoic acid |
|---|---|
| PubChem CID | 87460185 |
| Molecular Formula | C15H28O6 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 4-oxo-4-[4-(4-propoxybutoxy)butoxy]butanoic acid |
| SMILES | CCCOCCCCOCCCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C15H28O6/c1-2-9-19-10-3-4-11-20-12-5-6-13-21-15(18)8-7-14(16)17/h2-13H2,1H3,(H,16,17) |
| InChIKey | UPMZSLQHFNURNA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|