About 5-butanoyloxypentanoic acid
5-butanoyloxypentanoic acid (PubChem CID 54166172) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is 5-butanoyloxypentanoic acid.
Molecular Properties
| Compound Name | 5-butanoyloxypentanoic acid |
| PubChem CID | 54166172 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 5-butanoyloxypentanoic acid |
| SMILES | CCCC(=O)OCCCCC(=O)O |
| InChI | InChI=1S/C9H16O4/c1-2-5-9(12)13-7-4-3-6-8(10)11/h2-7H2,1H3,(H,10,11) |
| InChIKey | ZPXQWVXFOSFRSC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-butanoyloxypentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butanoyloxypentanoic acid?
The IUPAC name of 5-butanoyloxypentanoic acid (CID 54166172) is 5-butanoyloxypentanoic acid.
What is the SMILES notation for 5-butanoyloxypentanoic acid?
The canonical SMILES for 5-butanoyloxypentanoic acid is CCCC(=O)OCCCCC(=O)O.
What is the InChIKey of 5-butanoyloxypentanoic acid?
The InChIKey is ZPXQWVXFOSFRSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-2-5-9(12)13-7-4-3-6-8(10)11/h2-7H2,1H3,(H,10,11).
What are the key properties of 5-butanoyloxypentanoic acid?
5-butanoyloxypentanoic acid has a molecular weight of 188.22 g/mol, XLogP of 1.58, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butanoyloxypentanoic acid is sourced from PubChem (CID 54166172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).