C11H20O6 — CID 58559856
4-[2-(3-ethoxypropoxy)ethoxy]-4-oxobutanoic acid (PubChem CID 58559856) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is 4-[2-(3-ethoxypropoxy)ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-(3-ethoxypropoxy)ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58559856 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-[2-(3-ethoxypropoxy)ethoxy]-4-oxobutanoic acid |
| SMILES | CCOCCCOCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C11H20O6/c1-2-15-6-3-7-16-8-9-17-11(14)5-4-10(12)13/h2-9H2,1H3,(H,12,13) |
| InChIKey | YFNOVRHWMRLNCD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|