C16H26O9 — CID 88544057
6-[2-[2-(5-carboxypentanoyloxy)ethoxy]ethoxy]-6-oxohexanoic acid (PubChem CID 88544057) has the molecular formula C16H26O9 and a molecular weight of 362.38 g/mol. Its IUPAC name is 6-[2-[2-(5-carboxypentanoyloxy)ethoxy]ethoxy]-6-oxohexanoic acid.
| Compound Name | 6-[2-[2-(5-carboxypentanoyloxy)ethoxy]ethoxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 88544057 |
| Molecular Formula | C16H26O9 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 6-[2-[2-(5-carboxypentanoyloxy)ethoxy]ethoxy]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)OCCOCCOC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C16H26O9/c17-13(18)5-1-3-7-15(21)24-11-9-23-10-12-25-16(22)8-4-2-6-14(19)20/h1-12H2,(H,17,18)(H,19,20) |
| InChIKey | PAEQYJWCZQNWCA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|