C12H22O7 — CID 87303267
6-O-[2-(2-hydroxyethoxy)ethyl] 1-O-(2-hydroxyethyl) hexanedioate (PubChem CID 87303267) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is 6-O-[2-(2-hydroxyethoxy)ethyl] 1-O-(2-hydroxyethyl) hexanedioate.
| Compound Name | 6-O-[2-(2-hydroxyethoxy)ethyl] 1-O-(2-hydroxyethyl) hexanedioate |
|---|---|
| PubChem CID | 87303267 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 6-O-[2-(2-hydroxyethoxy)ethyl] 1-O-(2-hydroxyethyl) hexanedioate |
| SMILES | O=C(CCCCC(=O)OCCOCCO)OCCO |
| InChI | InChI=1S/C12H22O7/c13-5-7-17-9-10-19-12(16)4-2-1-3-11(15)18-8-6-14/h13-14H,1-10H2 |
| InChIKey | VFNQMCMTEJSCFZ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|