C11H23NO5 — CID 175059981
2-[2-(2-hydroxyethoxy)ethoxy]ethyl 5-aminopentanoate (PubChem CID 175059981) has the molecular formula C11H23NO5 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 5-aminopentanoate.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 5-aminopentanoate |
|---|---|
| PubChem CID | 175059981 |
| Molecular Formula | C11H23NO5 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 5-aminopentanoate |
| SMILES | NCCCCC(=O)OCCOCCOCCO |
| InChI | InChI=1S/C11H23NO5/c12-4-2-1-3-11(14)17-10-9-16-8-7-15-6-5-13/h13H,1-10,12H2 |
| InChIKey | HZAADVSYZQAFJG-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|