C11H20O5 — CID 118889300
2-(2-hydroxyethoxy)ethyl 6-oxoheptanoate (PubChem CID 118889300) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 6-oxoheptanoate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 6-oxoheptanoate |
|---|---|
| PubChem CID | 118889300 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 6-oxoheptanoate |
| SMILES | CC(=O)CCCCC(=O)OCCOCCO |
| InChI | InChI=1S/C11H20O5/c1-10(13)4-2-3-5-11(14)16-9-8-15-7-6-12/h12H,2-9H2,1H3 |
| InChIKey | NLMJUVOSAFANSF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|