C14H30O5 — CID 88656845
butane;2-[2-(2-hydroxyethoxy)ethoxy]ethyl butanoate (PubChem CID 88656845) has the molecular formula C14H30O5 and a molecular weight of 278.39 g/mol. Its IUPAC name is butane;2-[2-(2-hydroxyethoxy)ethoxy]ethyl butanoate.
| Compound Name | butane;2-[2-(2-hydroxyethoxy)ethoxy]ethyl butanoate |
|---|---|
| PubChem CID | 88656845 |
| Molecular Formula | C14H30O5 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | butane;2-[2-(2-hydroxyethoxy)ethoxy]ethyl butanoate |
| SMILES | CCCC.CCCC(=O)OCCOCCOCCO |
| InChI | InChI=1S/C10H20O5.C4H10/c1-2-3-10(12)15-9-8-14-7-6-13-5-4-11;1-3-4-2/h11H,2-9H2,1H3;3-4H2,1-2H3 |
| InChIKey | GFCJOIFSEMBTDR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|