C11H24O6 — CID 87568507
2-(2-hydroxyethoxy)ethanol;propyl 4-hydroxybutanoate (PubChem CID 87568507) has the molecular formula C11H24O6 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;propyl 4-hydroxybutanoate.
| Compound Name | 2-(2-hydroxyethoxy)ethanol;propyl 4-hydroxybutanoate |
|---|---|
| PubChem CID | 87568507 |
| Molecular Formula | C11H24O6 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;propyl 4-hydroxybutanoate |
| SMILES | CCCOC(=O)CCCO.OCCOCCO |
| InChI | InChI=1S/C7H14O3.C4H10O3/c1-2-6-10-7(9)4-3-5-8;5-1-3-7-4-2-6/h8H,2-6H2,1H3;5-6H,1-4H2 |
| InChIKey | URKCPLXCBPGVGJ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|