About 4-O-(2-hydroxyethyl) 1-O-propyl butanedioate
4-O-(2-hydroxyethyl) 1-O-propyl butanedioate (PubChem CID 87981334) has the molecular formula C9H16O5
and a molecular weight of 204.22 g/mol. Its IUPAC name is 4-O-(2-hydroxyethyl) 1-O-propyl butanedioate.
Molecular Properties
| Compound Name | 4-O-(2-hydroxyethyl) 1-O-propyl butanedioate |
| PubChem CID | 87981334 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 4-O-(2-hydroxyethyl) 1-O-propyl butanedioate |
| SMILES | CCCOC(=O)CCC(=O)OCCO |
| InChI | InChI=1S/C9H16O5/c1-2-6-13-8(11)3-4-9(12)14-7-5-10/h10H,2-7H2,1H3 |
| InChIKey | TXTQKIXQJVZELK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-O-(2-hydroxyethyl) 1-O-propyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2-hydroxyethyl) 1-O-propyl butanedioate?
The IUPAC name of 4-O-(2-hydroxyethyl) 1-O-propyl butanedioate (CID 87981334) is 4-O-(2-hydroxyethyl) 1-O-propyl butanedioate.
What is the SMILES notation for 4-O-(2-hydroxyethyl) 1-O-propyl butanedioate?
The canonical SMILES for 4-O-(2-hydroxyethyl) 1-O-propyl butanedioate is CCCOC(=O)CCC(=O)OCCO.
What is the InChIKey of 4-O-(2-hydroxyethyl) 1-O-propyl butanedioate?
The InChIKey is TXTQKIXQJVZELK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O5/c1-2-6-13-8(11)3-4-9(12)14-7-5-10/h10H,2-7H2,1H3.
What are the key properties of 4-O-(2-hydroxyethyl) 1-O-propyl butanedioate?
4-O-(2-hydroxyethyl) 1-O-propyl butanedioate has a molecular weight of 204.22 g/mol, XLogP of 0.26, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2-hydroxyethyl) 1-O-propyl butanedioate is sourced from PubChem (CID 87981334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).