About ethene;2-hydroxyethyl hexadecanoate
ethene;2-hydroxyethyl hexadecanoate (PubChem CID 87221064) has the molecular formula C20H40O3
and a molecular weight of 328.54 g/mol. Its IUPAC name is ethene;2-hydroxyethyl hexadecanoate.
Molecular Properties
| Compound Name | ethene;2-hydroxyethyl hexadecanoate |
| PubChem CID | 87221064 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | ethene;2-hydroxyethyl hexadecanoate |
| SMILES | C=C.CCCCCCCCCCCCCCCC(=O)OCCO |
| InChI | InChI=1S/C18H36O3.C2H4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(20)21-17-16-19;1-2/h19H,2-17H2,1H3;1-2H2 |
| InChIKey | DCGXNYCMRNZSAT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;2-hydroxyethyl hexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;2-hydroxyethyl hexadecanoate?
The IUPAC name of ethene;2-hydroxyethyl hexadecanoate (CID 87221064) is ethene;2-hydroxyethyl hexadecanoate.
What is the SMILES notation for ethene;2-hydroxyethyl hexadecanoate?
The canonical SMILES for ethene;2-hydroxyethyl hexadecanoate is C=C.CCCCCCCCCCCCCCCC(=O)OCCO.
What is the InChIKey of ethene;2-hydroxyethyl hexadecanoate?
The InChIKey is DCGXNYCMRNZSAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O3.C2H4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(20)21-17-16-19;1-2/h19H,2-17H2,1H3;1-2H2.
What are the key properties of ethene;2-hydroxyethyl hexadecanoate?
ethene;2-hydroxyethyl hexadecanoate has a molecular weight of 328.54 g/mol, XLogP of 5.81, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-hydroxyethyl hexadecanoate is sourced from PubChem (CID 87221064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).