About ethene;2-hydroxyethyl (Z)-octadec-9-enoate
ethene;2-hydroxyethyl (Z)-octadec-9-enoate (PubChem CID 173424780) has the molecular formula C36H70O3
and a molecular weight of 550.95 g/mol. Its IUPAC name is ethene;2-hydroxyethyl (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | ethene;2-hydroxyethyl (Z)-octadec-9-enoate |
| PubChem CID | 173424780 |
| Molecular Formula | C36H70O3 |
| Molecular Weight | 550.95 g/mol |
| Exact Mass | 550.53 |
| IUPAC Name | ethene;2-hydroxyethyl (Z)-octadec-9-enoate |
| SMILES | C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.CCCCCCCC/C=C\CCCCCCCC(=O)OCCO |
| InChI | InChI=1S/C20H38O3.8C2H4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)23-19-18-21;8*1-2/h9-10,21H,2-8,11-19H2,1H3;8*1-2H2/b10-9-;;;;;;;; |
| InChIKey | JTHWEWZCRVMRAK-UOFCSKMSSA-N |
| XLogP | 11.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.95 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;2-hydroxyethyl (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;2-hydroxyethyl (Z)-octadec-9-enoate?
The IUPAC name of ethene;2-hydroxyethyl (Z)-octadec-9-enoate (CID 173424780) is ethene;2-hydroxyethyl (Z)-octadec-9-enoate.
What is the SMILES notation for ethene;2-hydroxyethyl (Z)-octadec-9-enoate?
The canonical SMILES for ethene;2-hydroxyethyl (Z)-octadec-9-enoate is C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.CCCCCCCC/C=C\CCCCCCCC(=O)OCCO.
What is the InChIKey of ethene;2-hydroxyethyl (Z)-octadec-9-enoate?
The InChIKey is JTHWEWZCRVMRAK-UOFCSKMSSA-N. The full InChI is InChI=1S/C20H38O3.8C2H4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)23-19-18-21;8*1-2/h9-10,21H,2-8,11-19H2,1H3;8*1-2H2/b10-9-;;;;;;;;.
What are the key properties of ethene;2-hydroxyethyl (Z)-octadec-9-enoate?
ethene;2-hydroxyethyl (Z)-octadec-9-enoate has a molecular weight of 550.95 g/mol, XLogP of 11.98, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-hydroxyethyl (Z)-octadec-9-enoate is sourced from PubChem (CID 173424780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).