C24H46O5 — CID 22179243
2-[2-(2-hydroxyethoxy)ethoxy]ethyl (E)-octadec-9-enoate (PubChem CID 22179243) has the molecular formula C24H46O5 and a molecular weight of 414.63 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl (E)-octadec-9-enoate.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 22179243 |
| Molecular Formula | C24H46O5 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.33 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OCCOCCOCCO |
| InChI | InChI=1S/C24H46O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24(26)29-23-22-28-21-20-27-19-18-25/h9-10,25H,2-8,11-23H2,1H3/b10-9+ |
| InChIKey | RMLRKDHXZUVGCH-MDZDMXLPSA-N |
| XLogP | 5.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|