C46H88O9 — CID 159397818
2-[2-(2-hydroxyethoxy)ethoxy]ethyl (Z)-11-nonoxyundec-8-enoate;(Z)-11-nonoxyundec-8-enoic acid (PubChem CID 159397818) has the molecular formula C46H88O9 and a molecular weight of 785.20 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl (Z)-11-nonoxyundec-8-enoate;(Z)-11-nonoxyundec-8-enoic acid.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl (Z)-11-nonoxyundec-8-enoate;(Z)-11-nonoxyundec-8-enoic acid |
|---|---|
| PubChem CID | 159397818 |
| Molecular Formula | C46H88O9 |
| Molecular Weight | 785.20 g/mol |
| Exact Mass | 784.64 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl (Z)-11-nonoxyundec-8-enoate;(Z)-11-nonoxyundec-8-enoic acid |
| SMILES | CCCCCCCCCOCC/C=C\CCCCCCC(=O)O.CCCCCCCCCOCC/C=C\CCCCCCC(=O)OCCOCCOCCO |
| InChI | InChI=1S/C26H50O6.C20H38O3/c1-2-3-4-5-9-12-15-19-29-20-16-13-10-7-6-8-11-14-17-26(28)32-25-24-31-23-22-30-21-18-27;1-2-3-4-5-9-12-15-18-23-19-16-13-10-7-6-8-11-14-17-20(21)22/h10,13,27H,2-9,11-12,14-25H2,1H3;10,13H,2-9,11-12,14-19H2,1H3,(H,21,22)/b2*13-10- |
| InChIKey | LMYMFNPKFGPWTG-GLLPHPDXSA-N |
| XLogP | 11.73 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.20 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|