C22H38O4 — CID 140796459
2-(2-hydroxyethoxy)ethyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate (PubChem CID 140796459) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 140796459 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)OCCOCCO |
| InChI | InChI=1S/C22H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(24)26-21-20-25-19-18-23/h6-7,9-10,12-13,23H,2-5,8,11,14-21H2,1H3/b7-6-,10-9-,13-12- |
| InChIKey | JLBXITMUBUIVHM-QNEBEIHSSA-N |
| XLogP | 5.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|