C18H38O4 — CID 87130982
ethoxyethane;2-hydroxyethyl dodecanoate (PubChem CID 87130982) has the molecular formula C18H38O4 and a molecular weight of 318.50 g/mol. Its IUPAC name is ethoxyethane;2-hydroxyethyl dodecanoate.
| Compound Name | ethoxyethane;2-hydroxyethyl dodecanoate |
|---|---|
| PubChem CID | 87130982 |
| Molecular Formula | C18H38O4 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | ethoxyethane;2-hydroxyethyl dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)OCCO.CCOCC |
| InChI | InChI=1S/C14H28O3.C4H10O/c1-2-3-4-5-6-7-8-9-10-11-14(16)17-13-12-15;1-3-5-4-2/h15H,2-13H2,1H3;3-4H2,1-2H3 |
| InChIKey | LZVLWOBTVGGACA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|