About 2-butanoyloxyethyl butanoate;methane
2-butanoyloxyethyl butanoate;methane (PubChem CID 161018761) has the molecular formula C12H26O4
and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-butanoyloxyethyl butanoate;methane.
Molecular Properties
| Compound Name | 2-butanoyloxyethyl butanoate;methane |
| PubChem CID | 161018761 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 2-butanoyloxyethyl butanoate;methane |
| SMILES | C.C.CCCC(=O)OCCOC(=O)CCC |
| InChI | InChI=1S/C10H18O4.2CH4/c1-3-5-9(11)13-7-8-14-10(12)6-4-2;;/h3-8H2,1-2H3;2*1H4 |
| InChIKey | TYBRIZAOMVZYGH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butanoyloxyethyl butanoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butanoyloxyethyl butanoate;methane?
The IUPAC name of 2-butanoyloxyethyl butanoate;methane (CID 161018761) is 2-butanoyloxyethyl butanoate;methane.
What is the SMILES notation for 2-butanoyloxyethyl butanoate;methane?
The canonical SMILES for 2-butanoyloxyethyl butanoate;methane is C.C.CCCC(=O)OCCOC(=O)CCC.
What is the InChIKey of 2-butanoyloxyethyl butanoate;methane?
The InChIKey is TYBRIZAOMVZYGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4.2CH4/c1-3-5-9(11)13-7-8-14-10(12)6-4-2;;/h3-8H2,1-2H3;2*1H4.
What are the key properties of 2-butanoyloxyethyl butanoate;methane?
2-butanoyloxyethyl butanoate;methane has a molecular weight of 234.34 g/mol, XLogP of 2.95, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butanoyloxyethyl butanoate;methane is sourced from PubChem (CID 161018761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).