About 3-butanoyloxypropanoic acid;ethane
3-butanoyloxypropanoic acid;ethane (PubChem CID 159299960) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is 3-butanoyloxypropanoic acid;ethane.
Molecular Properties
| Compound Name | 3-butanoyloxypropanoic acid;ethane |
| PubChem CID | 159299960 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 3-butanoyloxypropanoic acid;ethane |
| SMILES | CC.CCCC(=O)OCCC(=O)O |
| InChI | InChI=1S/C7H12O4.C2H6/c1-2-3-7(10)11-5-4-6(8)9;1-2/h2-5H2,1H3,(H,8,9);1-2H3 |
| InChIKey | LBFAJIYDIMRHKU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-butanoyloxypropanoic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butanoyloxypropanoic acid;ethane?
The IUPAC name of 3-butanoyloxypropanoic acid;ethane (CID 159299960) is 3-butanoyloxypropanoic acid;ethane.
What is the SMILES notation for 3-butanoyloxypropanoic acid;ethane?
The canonical SMILES for 3-butanoyloxypropanoic acid;ethane is CC.CCCC(=O)OCCC(=O)O.
What is the InChIKey of 3-butanoyloxypropanoic acid;ethane?
The InChIKey is LBFAJIYDIMRHKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4.C2H6/c1-2-3-7(10)11-5-4-6(8)9;1-2/h2-5H2,1H3,(H,8,9);1-2H3.
What are the key properties of 3-butanoyloxypropanoic acid;ethane?
3-butanoyloxypropanoic acid;ethane has a molecular weight of 190.24 g/mol, XLogP of 1.83, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butanoyloxypropanoic acid;ethane is sourced from PubChem (CID 159299960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).