About CID 161369205
CID 161369205 (PubChem CID 161369205) has the molecular formula C18H36NaO4
and a molecular weight of 339.47 g/mol.
Molecular Properties
| Compound Name | CID 161369205 |
| PubChem CID | 161369205 |
| Molecular Formula | C18H36NaO4 |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | — |
| SMILES | CCCCCOC(=O)CCC.CCCCCOC(=O)CCC.[Na] |
| InChI | InChI=1S/2C9H18O2.Na/c2*1-3-5-6-8-11-9(10)7-4-2;/h2*3-8H2,1-2H3; |
| InChIKey | OSOUVRPBZFTYNQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 161369205 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161369205?
The IUPAC name of CID 161369205 (CID 161369205) is not available.
What is the SMILES notation for CID 161369205?
The canonical SMILES for CID 161369205 is CCCCCOC(=O)CCC.CCCCCOC(=O)CCC.[Na].
What is the InChIKey of CID 161369205?
The InChIKey is OSOUVRPBZFTYNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H18O2.Na/c2*1-3-5-6-8-11-9(10)7-4-2;/h2*3-8H2,1-2H3;.
What are the key properties of CID 161369205?
CID 161369205 has a molecular weight of 339.47 g/mol, XLogP of 4.66, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161369205 is sourced from PubChem (CID 161369205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).