About butane;dodecyl butanoate
butane;dodecyl butanoate (PubChem CID 91569021) has the molecular formula C20H42O2
and a molecular weight of 314.55 g/mol. Its IUPAC name is butane;dodecyl butanoate.
Molecular Properties
| Compound Name | butane;dodecyl butanoate |
| PubChem CID | 91569021 |
| Molecular Formula | C20H42O2 |
| Molecular Weight | 314.55 g/mol |
| Exact Mass | 314.32 |
| IUPAC Name | butane;dodecyl butanoate |
| SMILES | CCCC.CCCCCCCCCCCCOC(=O)CCC |
| InChI | InChI=1S/C16H32O2.C4H10/c1-3-5-6-7-8-9-10-11-12-13-15-18-16(17)14-4-2;1-3-4-2/h3-15H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | CMBWAHZBOJYBBX-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.55 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butane;dodecyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;dodecyl butanoate?
The IUPAC name of butane;dodecyl butanoate (CID 91569021) is butane;dodecyl butanoate.
What is the SMILES notation for butane;dodecyl butanoate?
The canonical SMILES for butane;dodecyl butanoate is CCCC.CCCCCCCCCCCCOC(=O)CCC.
What is the InChIKey of butane;dodecyl butanoate?
The InChIKey is CMBWAHZBOJYBBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2.C4H10/c1-3-5-6-7-8-9-10-11-12-13-15-18-16(17)14-4-2;1-3-4-2/h3-15H2,1-2H3;3-4H2,1-2H3.
What are the key properties of butane;dodecyl butanoate?
butane;dodecyl butanoate has a molecular weight of 314.55 g/mol, XLogP of 7.06, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;dodecyl butanoate is sourced from PubChem (CID 91569021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).