About 2-carboxyoxyethyl butanoate
2-carboxyoxyethyl butanoate (PubChem CID 140975603) has the molecular formula C7H12O5
and a molecular weight of 176.17 g/mol. Its IUPAC name is 2-carboxyoxyethyl butanoate.
Molecular Properties
| Compound Name | 2-carboxyoxyethyl butanoate |
| PubChem CID | 140975603 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 2-carboxyoxyethyl butanoate |
| SMILES | CCCC(=O)OCCOC(=O)O |
| InChI | InChI=1S/C7H12O5/c1-2-3-6(8)11-4-5-12-7(9)10/h2-5H2,1H3,(H,9,10) |
| InChIKey | OLDAUCWWHICYRR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxyoxyethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyoxyethyl butanoate?
The IUPAC name of 2-carboxyoxyethyl butanoate (CID 140975603) is 2-carboxyoxyethyl butanoate.
What is the SMILES notation for 2-carboxyoxyethyl butanoate?
The canonical SMILES for 2-carboxyoxyethyl butanoate is CCCC(=O)OCCOC(=O)O.
What is the InChIKey of 2-carboxyoxyethyl butanoate?
The InChIKey is OLDAUCWWHICYRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O5/c1-2-3-6(8)11-4-5-12-7(9)10/h2-5H2,1H3,(H,9,10).
What are the key properties of 2-carboxyoxyethyl butanoate?
2-carboxyoxyethyl butanoate has a molecular weight of 176.17 g/mol, XLogP of 1.02, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyoxyethyl butanoate is sourced from PubChem (CID 140975603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).