About 2-butanoyloxyethyl 2-bromo-2-methylpropanoate
2-butanoyloxyethyl 2-bromo-2-methylpropanoate (PubChem CID 177392041) has the molecular formula C10H17BrO4
and a molecular weight of 281.15 g/mol. Its IUPAC name is 2-butanoyloxyethyl 2-bromo-2-methylpropanoate.
Molecular Properties
| Compound Name | 2-butanoyloxyethyl 2-bromo-2-methylpropanoate |
| PubChem CID | 177392041 |
| Molecular Formula | C10H17BrO4 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-butanoyloxyethyl 2-bromo-2-methylpropanoate |
| SMILES | CCCC(=O)OCCOC(=O)C(C)(C)Br |
| InChI | InChI=1S/C10H17BrO4/c1-4-5-8(12)14-6-7-15-9(13)10(2,3)11/h4-7H2,1-3H3 |
| InChIKey | VHUYXPHXEJGOLZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-butanoyloxyethyl 2-bromo-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butanoyloxyethyl 2-bromo-2-methylpropanoate?
The IUPAC name of 2-butanoyloxyethyl 2-bromo-2-methylpropanoate (CID 177392041) is 2-butanoyloxyethyl 2-bromo-2-methylpropanoate.
What is the SMILES notation for 2-butanoyloxyethyl 2-bromo-2-methylpropanoate?
The canonical SMILES for 2-butanoyloxyethyl 2-bromo-2-methylpropanoate is CCCC(=O)OCCOC(=O)C(C)(C)Br.
What is the InChIKey of 2-butanoyloxyethyl 2-bromo-2-methylpropanoate?
The InChIKey is VHUYXPHXEJGOLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17BrO4/c1-4-5-8(12)14-6-7-15-9(13)10(2,3)11/h4-7H2,1-3H3.
What are the key properties of 2-butanoyloxyethyl 2-bromo-2-methylpropanoate?
2-butanoyloxyethyl 2-bromo-2-methylpropanoate has a molecular weight of 281.15 g/mol, XLogP of 2.05, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butanoyloxyethyl 2-bromo-2-methylpropanoate is sourced from PubChem (CID 177392041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).