C19H37BrO9 — CID 11038281
2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-bromo-2-methylpropanoate (PubChem CID 11038281) has the molecular formula C19H37BrO9 and a molecular weight of 489.40 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-bromo-2-methylpropanoate.
| Compound Name | 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 11038281 |
| Molecular Formula | C19H37BrO9 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-bromo-2-methylpropanoate |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOC(=O)C(C)(C)Br |
| InChI | InChI=1S/C19H37BrO9/c1-19(2,20)18(21)29-17-16-28-15-14-27-13-12-26-11-10-25-9-8-24-7-6-23-5-4-22-3/h4-17H2,1-3H3 |
| InChIKey | WHNVDKXBAJHUAO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|