C27H50O16 — CID 139400465
tris[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 139400465) has the molecular formula C27H50O16 and a molecular weight of 630.68 g/mol. Its IUPAC name is tris[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | tris[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 139400465 |
| Molecular Formula | C27H50O16 |
| Molecular Weight | 630.68 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | tris[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | COCCOCCOCCOC(=O)CC(O)(CC(=O)OCCOCCOCCOC)C(=O)OCCOCCOCCOC |
| InChI | InChI=1S/C27H50O16/c1-32-4-7-35-10-13-38-16-19-41-24(28)22-27(31,26(30)43-21-18-40-15-12-37-9-6-34-3)23-25(29)42-20-17-39-14-11-36-8-5-33-2/h31H,4-23H2,1-3H3 |
| InChIKey | GBNUVHXLKMXDQI-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 182.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.68 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|