C24H44O7 — CID 126563397
2-O-butyl 1-O,3-O-diheptyl 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 126563397) has the molecular formula C24H44O7 and a molecular weight of 444.61 g/mol. Its IUPAC name is 2-O-butyl 1-O,3-O-diheptyl 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | 2-O-butyl 1-O,3-O-diheptyl 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 126563397 |
| Molecular Formula | C24H44O7 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 2-O-butyl 1-O,3-O-diheptyl 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CCCCCCCOC(=O)CC(O)(CC(=O)OCCCCCCC)C(=O)OCCCC |
| InChI | InChI=1S/C24H44O7/c1-4-7-10-12-14-17-29-21(25)19-24(28,23(27)31-16-9-6-3)20-22(26)30-18-15-13-11-8-5-2/h28H,4-20H2,1-3H3 |
| InChIKey | NJDGVHSIZVQKPO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|