C16H26O8 — CID 18410541
1-O-acetyl 2-O,3-O-dibutyl 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 18410541) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-O-acetyl 2-O,3-O-dibutyl 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | 1-O-acetyl 2-O,3-O-dibutyl 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 18410541 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-O-acetyl 2-O,3-O-dibutyl 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CCCCOC(=O)CC(O)(CC(=O)OC(C)=O)C(=O)OCCCC |
| InChI | InChI=1S/C16H26O8/c1-4-6-8-22-13(18)10-16(21,11-14(19)24-12(3)17)15(20)23-9-7-5-2/h21H,4-11H2,1-3H3 |
| InChIKey | FHSISXMGVWEJMG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|