C18H34O8 — CID 141282319
tributyl 2-hydroxypropane-1,2,3-tricarboxylate;hydrate (PubChem CID 141282319) has the molecular formula C18H34O8 and a molecular weight of 378.46 g/mol. Its IUPAC name is tributyl 2-hydroxypropane-1,2,3-tricarboxylate;hydrate.
| Compound Name | tributyl 2-hydroxypropane-1,2,3-tricarboxylate;hydrate |
|---|---|
| PubChem CID | 141282319 |
| Molecular Formula | C18H34O8 |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | tributyl 2-hydroxypropane-1,2,3-tricarboxylate;hydrate |
| SMILES | CCCCOC(=O)CC(O)(CC(=O)OCCCC)C(=O)OCCCC.O |
| InChI | InChI=1S/C18H32O7.H2O/c1-4-7-10-23-15(19)13-18(22,17(21)25-12-9-6-3)14-16(20)24-11-8-5-2;/h22H,4-14H2,1-3H3;1H2 |
| InChIKey | KKIMWONZALWXMW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|