C21H35NO7 — CID 174577355
azete;tributyl 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 174577355) has the molecular formula C21H35NO7 and a molecular weight of 413.51 g/mol. Its IUPAC name is azete;tributyl 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | azete;tributyl 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 174577355 |
| Molecular Formula | C21H35NO7 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | azete;tributyl 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | C1=CN=C1.CCCCOC(=O)CC(O)(CC(=O)OCCCC)C(=O)OCCCC |
| InChI | InChI=1S/C18H32O7.C3H3N/c1-4-7-10-23-15(19)13-18(22,17(21)25-12-9-6-3)14-16(20)24-11-8-5-2;1-2-4-3-1/h22H,4-14H2,1-3H3;1-3H |
| InChIKey | FLLNYHJXLHIZCY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|