C30H56O9 — CID 87505764
trioctyl 1,1,2-trihydroxypropane-1,2,3-tricarboxylate (PubChem CID 87505764) has the molecular formula C30H56O9 and a molecular weight of 560.77 g/mol. Its IUPAC name is trioctyl 1,1,2-trihydroxypropane-1,2,3-tricarboxylate.
| Compound Name | trioctyl 1,1,2-trihydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 87505764 |
| Molecular Formula | C30H56O9 |
| Molecular Weight | 560.77 g/mol |
| Exact Mass | 560.39 |
| IUPAC Name | trioctyl 1,1,2-trihydroxypropane-1,2,3-tricarboxylate |
| SMILES | CCCCCCCCOC(=O)CC(O)(C(=O)OCCCCCCCC)C(O)(O)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C30H56O9/c1-4-7-10-13-16-19-22-37-26(31)25-29(34,27(32)38-23-20-17-14-11-8-5-2)30(35,36)28(33)39-24-21-18-15-12-9-6-3/h34-36H,4-25H2,1-3H3 |
| InChIKey | ABQISLAESTYMIS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.77 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|