C28H52O7 — CID 175220930
1-O-butyl 2-O,3-O-dihexyl 2-hexoxypropane-1,2,3-tricarboxylate (PubChem CID 175220930) has the molecular formula C28H52O7 and a molecular weight of 500.72 g/mol. Its IUPAC name is 1-O-butyl 2-O,3-O-dihexyl 2-hexoxypropane-1,2,3-tricarboxylate.
| Compound Name | 1-O-butyl 2-O,3-O-dihexyl 2-hexoxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 175220930 |
| Molecular Formula | C28H52O7 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | 1-O-butyl 2-O,3-O-dihexyl 2-hexoxypropane-1,2,3-tricarboxylate |
| SMILES | CCCCCCOC(=O)CC(CC(=O)OCCCC)(OCCCCCC)C(=O)OCCCCCC |
| InChI | InChI=1S/C28H52O7/c1-5-9-13-16-20-33-26(30)24-28(35-22-18-15-11-7-3,23-25(29)32-19-12-8-4)27(31)34-21-17-14-10-6-2/h5-24H2,1-4H3 |
| InChIKey | RBGZFVAFMHGRAZ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|