C28H50O8 — CID 87290635
1-O-butanoyl 2-O,3-O-dihexyl 2-hexoxypropane-1,2,3-tricarboxylate (PubChem CID 87290635) has the molecular formula C28H50O8 and a molecular weight of 514.70 g/mol. Its IUPAC name is 1-O-butanoyl 2-O,3-O-dihexyl 2-hexoxypropane-1,2,3-tricarboxylate.
| Compound Name | 1-O-butanoyl 2-O,3-O-dihexyl 2-hexoxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 87290635 |
| Molecular Formula | C28H50O8 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | 1-O-butanoyl 2-O,3-O-dihexyl 2-hexoxypropane-1,2,3-tricarboxylate |
| SMILES | CCCCCCOC(=O)CC(CC(=O)OC(=O)CCC)(OCCCCCC)C(=O)OCCCCCC |
| InChI | InChI=1S/C28H50O8/c1-5-9-12-15-19-33-25(30)22-28(35-21-17-14-11-7-3,23-26(31)36-24(29)18-8-4)27(32)34-20-16-13-10-6-2/h5-23H2,1-4H3 |
| InChIKey | SABAAPFRAHACKB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|