C24H42O8 — CID 175117051
1-O,2-O-dibutyl 3-O-hexanoyl 2-butoxypropane-1,2,3-tricarboxylate (PubChem CID 175117051) has the molecular formula C24H42O8 and a molecular weight of 458.59 g/mol. Its IUPAC name is 1-O,2-O-dibutyl 3-O-hexanoyl 2-butoxypropane-1,2,3-tricarboxylate.
| Compound Name | 1-O,2-O-dibutyl 3-O-hexanoyl 2-butoxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 175117051 |
| Molecular Formula | C24H42O8 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 1-O,2-O-dibutyl 3-O-hexanoyl 2-butoxypropane-1,2,3-tricarboxylate |
| SMILES | CCCCCC(=O)OC(=O)CC(CC(=O)OCCCC)(OCCCC)C(=O)OCCCC |
| InChI | InChI=1S/C24H42O8/c1-5-9-13-14-20(25)32-22(27)19-24(31-17-12-8-4,23(28)30-16-11-7-3)18-21(26)29-15-10-6-2/h5-19H2,1-4H3 |
| InChIKey | FXSIHXJCDQJFJZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|