C20H34O9 — CID 174395446
1-O,2-O-dibutyl 3-O-(2-hydroxyacetyl) 2-butoxypropane-1,2,3-tricarboxylate (PubChem CID 174395446) has the molecular formula C20H34O9 and a molecular weight of 418.48 g/mol. Its IUPAC name is 1-O,2-O-dibutyl 3-O-(2-hydroxyacetyl) 2-butoxypropane-1,2,3-tricarboxylate.
| Compound Name | 1-O,2-O-dibutyl 3-O-(2-hydroxyacetyl) 2-butoxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 174395446 |
| Molecular Formula | C20H34O9 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 1-O,2-O-dibutyl 3-O-(2-hydroxyacetyl) 2-butoxypropane-1,2,3-tricarboxylate |
| SMILES | CCCCOC(=O)CC(CC(=O)OC(=O)CO)(OCCCC)C(=O)OCCCC |
| InChI | InChI=1S/C20H34O9/c1-4-7-10-26-16(22)13-20(28-12-9-6-3,19(25)27-11-8-5-2)14-17(23)29-18(24)15-21/h21H,4-15H2,1-3H3 |
| InChIKey | WHNHSEMDPAELHS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|