C20H34O9 — CID 175460349
2-(3,5-dibutoxy-3-butoxycarbonyl-5-oxopentanoyl)oxyacetic acid (PubChem CID 175460349) has the molecular formula C20H34O9 and a molecular weight of 418.48 g/mol. Its IUPAC name is 2-(3,5-dibutoxy-3-butoxycarbonyl-5-oxopentanoyl)oxyacetic acid.
| Compound Name | 2-(3,5-dibutoxy-3-butoxycarbonyl-5-oxopentanoyl)oxyacetic acid |
|---|---|
| PubChem CID | 175460349 |
| Molecular Formula | C20H34O9 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 2-(3,5-dibutoxy-3-butoxycarbonyl-5-oxopentanoyl)oxyacetic acid |
| SMILES | CCCCOC(=O)CC(CC(=O)OCC(=O)O)(OCCCC)C(=O)OCCCC |
| InChI | InChI=1S/C20H34O9/c1-4-7-10-26-17(23)13-20(29-12-9-6-3,19(25)27-11-8-5-2)14-18(24)28-15-16(21)22/h4-15H2,1-3H3,(H,21,22) |
| InChIKey | MOYFYRGBWGBDQF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|