C23H42O7 — CID 87499895
tributyl 2-pentoxypropane-1,2,3-tricarboxylate (PubChem CID 87499895) has the molecular formula C23H42O7 and a molecular weight of 430.58 g/mol. Its IUPAC name is tributyl 2-pentoxypropane-1,2,3-tricarboxylate.
| Compound Name | tributyl 2-pentoxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 87499895 |
| Molecular Formula | C23H42O7 |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | tributyl 2-pentoxypropane-1,2,3-tricarboxylate |
| SMILES | CCCCCOC(CC(=O)OCCCC)(CC(=O)OCCCC)C(=O)OCCCC |
| InChI | InChI=1S/C23H42O7/c1-5-9-13-17-30-23(22(26)29-16-12-8-4,18-20(24)27-14-10-6-2)19-21(25)28-15-11-7-3/h5-19H2,1-4H3 |
| InChIKey | WKERMPSSNZQBLS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|