C31H58O13 — CID 142701626
tris[2-(2-butoxyethoxy)ethyl] 2-methoxypropane-1,2,3-tricarboxylate (PubChem CID 142701626) has the molecular formula C31H58O13 and a molecular weight of 638.79 g/mol. Its IUPAC name is tris[2-(2-butoxyethoxy)ethyl] 2-methoxypropane-1,2,3-tricarboxylate.
| Compound Name | tris[2-(2-butoxyethoxy)ethyl] 2-methoxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 142701626 |
| Molecular Formula | C31H58O13 |
| Molecular Weight | 638.79 g/mol |
| Exact Mass | 638.39 |
| IUPAC Name | tris[2-(2-butoxyethoxy)ethyl] 2-methoxypropane-1,2,3-tricarboxylate |
| SMILES | CCCCOCCOCCOC(=O)CC(CC(=O)OCCOCCOCCCC)(OC)C(=O)OCCOCCOCCCC |
| InChI | InChI=1S/C31H58O13/c1-5-8-11-36-14-17-39-20-23-42-28(32)26-31(35-4,30(34)44-25-22-41-19-16-38-13-10-7-3)27-29(33)43-24-21-40-18-15-37-12-9-6-2/h5-27H2,1-4H3 |
| InChIKey | LQVGSVUCXOLSJO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 143.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|