About 2-butoxyethyl 2-aminoacetate
2-butoxyethyl 2-aminoacetate (PubChem CID 61304060) has the molecular formula C8H17NO3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-butoxyethyl 2-aminoacetate.
Molecular Properties
| Compound Name | 2-butoxyethyl 2-aminoacetate |
| PubChem CID | 61304060 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 2-butoxyethyl 2-aminoacetate |
| SMILES | CCCCOCCOC(=O)CN |
| InChI | InChI=1S/C8H17NO3/c1-2-3-4-11-5-6-12-8(10)7-9/h2-7,9H2,1H3 |
| InChIKey | JBZZVDLGJDYPEW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxyethyl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxyethyl 2-aminoacetate?
The IUPAC name of 2-butoxyethyl 2-aminoacetate (CID 61304060) is 2-butoxyethyl 2-aminoacetate.
What is the SMILES notation for 2-butoxyethyl 2-aminoacetate?
The canonical SMILES for 2-butoxyethyl 2-aminoacetate is CCCCOCCOC(=O)CN.
What is the InChIKey of 2-butoxyethyl 2-aminoacetate?
The InChIKey is JBZZVDLGJDYPEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3/c1-2-3-4-11-5-6-12-8(10)7-9/h2-7,9H2,1H3.
What are the key properties of 2-butoxyethyl 2-aminoacetate?
2-butoxyethyl 2-aminoacetate has a molecular weight of 175.23 g/mol, XLogP of 0.31, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxyethyl 2-aminoacetate is sourced from PubChem (CID 61304060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).