About 2-(2-butoxyethoxy)ethyl 2-chloroacetate
2-(2-butoxyethoxy)ethyl 2-chloroacetate (PubChem CID 13259947) has the molecular formula C10H19ClO4
and a molecular weight of 238.71 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)ethyl 2-chloroacetate.
Molecular Properties
| Compound Name | 2-(2-butoxyethoxy)ethyl 2-chloroacetate |
| PubChem CID | 13259947 |
| Molecular Formula | C10H19ClO4 |
| Molecular Weight | 238.71 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-(2-butoxyethoxy)ethyl 2-chloroacetate |
| SMILES | CCCCOCCOCCOC(=O)CCl |
| InChI | InChI=1S/C10H19ClO4/c1-2-3-4-13-5-6-14-7-8-15-10(12)9-11/h2-9H2,1H3 |
| InChIKey | JXFHXVGLAOFHQZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.71 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-butoxyethoxy)ethyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-butoxyethoxy)ethyl 2-chloroacetate?
The IUPAC name of 2-(2-butoxyethoxy)ethyl 2-chloroacetate (CID 13259947) is 2-(2-butoxyethoxy)ethyl 2-chloroacetate.
What is the SMILES notation for 2-(2-butoxyethoxy)ethyl 2-chloroacetate?
The canonical SMILES for 2-(2-butoxyethoxy)ethyl 2-chloroacetate is CCCCOCCOCCOC(=O)CCl.
What is the InChIKey of 2-(2-butoxyethoxy)ethyl 2-chloroacetate?
The InChIKey is JXFHXVGLAOFHQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19ClO4/c1-2-3-4-13-5-6-14-7-8-15-10(12)9-11/h2-9H2,1H3.
What are the key properties of 2-(2-butoxyethoxy)ethyl 2-chloroacetate?
2-(2-butoxyethoxy)ethyl 2-chloroacetate has a molecular weight of 238.71 g/mol, XLogP of 1.60, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butoxyethoxy)ethyl 2-chloroacetate is sourced from PubChem (CID 13259947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).