About 2-(2-butoxyethoxy)ethyl acetate;methane
2-(2-butoxyethoxy)ethyl acetate;methane (PubChem CID 87739734) has the molecular formula C11H24O4
and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)ethyl acetate;methane.
Molecular Properties
| Compound Name | 2-(2-butoxyethoxy)ethyl acetate;methane |
| PubChem CID | 87739734 |
| Molecular Formula | C11H24O4 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 2-(2-butoxyethoxy)ethyl acetate;methane |
| SMILES | C.CCCCOCCOCCOC(C)=O |
| InChI | InChI=1S/C10H20O4.CH4/c1-3-4-5-12-6-7-13-8-9-14-10(2)11;/h3-9H2,1-2H3;1H4 |
| InChIKey | LRQDYDBDKFVJCU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-butoxyethoxy)ethyl acetate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-butoxyethoxy)ethyl acetate;methane?
The IUPAC name of 2-(2-butoxyethoxy)ethyl acetate;methane (CID 87739734) is 2-(2-butoxyethoxy)ethyl acetate;methane.
What is the SMILES notation for 2-(2-butoxyethoxy)ethyl acetate;methane?
The canonical SMILES for 2-(2-butoxyethoxy)ethyl acetate;methane is C.CCCCOCCOCCOC(C)=O.
What is the InChIKey of 2-(2-butoxyethoxy)ethyl acetate;methane?
The InChIKey is LRQDYDBDKFVJCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4.CH4/c1-3-4-5-12-6-7-13-8-9-14-10(2)11;/h3-9H2,1-2H3;1H4.
What are the key properties of 2-(2-butoxyethoxy)ethyl acetate;methane?
2-(2-butoxyethoxy)ethyl acetate;methane has a molecular weight of 220.31 g/mol, XLogP of 2.02, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butoxyethoxy)ethyl acetate;methane is sourced from PubChem (CID 87739734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).