About 2-butoxyethyl acetate;4-methylpentan-2-one
2-butoxyethyl acetate;4-methylpentan-2-one (PubChem CID 157145416) has the molecular formula C14H28O4
and a molecular weight of 260.37 g/mol. Its IUPAC name is 2-butoxyethyl acetate;4-methylpentan-2-one.
Molecular Properties
| Compound Name | 2-butoxyethyl acetate;4-methylpentan-2-one |
| PubChem CID | 157145416 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 2-butoxyethyl acetate;4-methylpentan-2-one |
| SMILES | CC(=O)CC(C)C.CCCCOCCOC(C)=O |
| InChI | InChI=1S/C8H16O3.C6H12O/c1-3-4-5-10-6-7-11-8(2)9;1-5(2)4-6(3)7/h3-7H2,1-2H3;5H,4H2,1-3H3 |
| InChIKey | AKQJSYRCBFJNAF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxyethyl acetate;4-methylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxyethyl acetate;4-methylpentan-2-one?
The IUPAC name of 2-butoxyethyl acetate;4-methylpentan-2-one (CID 157145416) is 2-butoxyethyl acetate;4-methylpentan-2-one.
What is the SMILES notation for 2-butoxyethyl acetate;4-methylpentan-2-one?
The canonical SMILES for 2-butoxyethyl acetate;4-methylpentan-2-one is CC(=O)CC(C)C.CCCCOCCOC(C)=O.
What is the InChIKey of 2-butoxyethyl acetate;4-methylpentan-2-one?
The InChIKey is AKQJSYRCBFJNAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3.C6H12O/c1-3-4-5-10-6-7-11-8(2)9;1-5(2)4-6(3)7/h3-7H2,1-2H3;5H,4H2,1-3H3.
What are the key properties of 2-butoxyethyl acetate;4-methylpentan-2-one?
2-butoxyethyl acetate;4-methylpentan-2-one has a molecular weight of 260.37 g/mol, XLogP of 2.99, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxyethyl acetate;4-methylpentan-2-one is sourced from PubChem (CID 157145416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).