About 2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate
2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate (PubChem CID 161493790) has the molecular formula C16H34O7
and a molecular weight of 338.44 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate.
Molecular Properties
| Compound Name | 2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate |
| PubChem CID | 161493790 |
| Molecular Formula | C16H34O7 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate |
| SMILES | CCCCOCCOCCO.CCOCCOCCOC(C)=O |
| InChI | InChI=1S/C8H16O4.C8H18O3/c1-3-10-4-5-11-6-7-12-8(2)9;1-2-3-5-10-7-8-11-6-4-9/h3-7H2,1-2H3;9H,2-8H2,1H3 |
| InChIKey | WFYCBGWTNFUTME-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate?
The IUPAC name of 2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate (CID 161493790) is 2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate.
What is the SMILES notation for 2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate?
The canonical SMILES for 2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate is CCCCOCCOCCO.CCOCCOCCOC(C)=O.
What is the InChIKey of 2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate?
The InChIKey is WFYCBGWTNFUTME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4.C8H18O3/c1-3-10-4-5-11-6-7-12-8(2)9;1-2-3-5-10-7-8-11-6-4-9/h3-7H2,1-2H3;9H,2-8H2,1H3.
What are the key properties of 2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate?
2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate has a molecular weight of 338.44 g/mol, XLogP of 1.41, 15 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butoxyethoxy)ethanol;2-(2-ethoxyethoxy)ethyl acetate is sourced from PubChem (CID 161493790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).