About 2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol
2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol (PubChem CID 158203924) has the molecular formula C16H36O8
and a molecular weight of 356.46 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol.
Molecular Properties
| Compound Name | 2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol |
| PubChem CID | 158203924 |
| Molecular Formula | C16H36O8 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol |
| SMILES | CCCCOCCOCCO.CCOC(C)=O.OCCOCCO |
| InChI | InChI=1S/C8H18O3.C4H10O3.C4H8O2/c1-2-3-5-10-7-8-11-6-4-9;5-1-3-7-4-2-6;1-3-6-4(2)5/h9H,2-8H2,1H3;5-6H,1-4H2;3H2,1-2H3 |
| InChIKey | GBGOEFCBALWARD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol?
The IUPAC name of 2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol (CID 158203924) is 2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol.
What is the SMILES notation for 2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol?
The canonical SMILES for 2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol is CCCCOCCOCCO.CCOC(C)=O.OCCOCCO.
What is the InChIKey of 2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol?
The InChIKey is GBGOEFCBALWARD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3.C4H10O3.C4H8O2/c1-2-3-5-10-7-8-11-6-4-9;5-1-3-7-4-2-6;1-3-6-4(2)5/h9H,2-8H2,1H3;5-6H,1-4H2;3H2,1-2H3.
What are the key properties of 2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol?
2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol has a molecular weight of 356.46 g/mol, XLogP of 0.37, 13 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butoxyethoxy)ethanol;ethyl acetate;2-(2-hydroxyethoxy)ethanol is sourced from PubChem (CID 158203924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).