About 2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol
2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol (PubChem CID 174793686) has the molecular formula C17H38O8
and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol.
Molecular Properties
| Compound Name | 2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol |
| PubChem CID | 174793686 |
| Molecular Formula | C17H38O8 |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol |
| SMILES | CCCCOCCOCCO.COCC(C)O.COCCOC(C)=O |
| InChI | InChI=1S/C8H18O3.C5H10O3.C4H10O2/c1-2-3-5-10-7-8-11-6-4-9;1-5(6)8-4-3-7-2;1-4(5)3-6-2/h9H,2-8H2,1H3;3-4H2,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | VWJGHGXQNYDIRB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol?
The IUPAC name of 2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol (CID 174793686) is 2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol.
What is the SMILES notation for 2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol?
The canonical SMILES for 2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol is CCCCOCCOCCO.COCC(C)O.COCCOC(C)=O.
What is the InChIKey of 2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol?
The InChIKey is VWJGHGXQNYDIRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3.C5H10O3.C4H10O2/c1-2-3-5-10-7-8-11-6-4-9;1-5(6)8-4-3-7-2;1-4(5)3-6-2/h9H,2-8H2,1H3;3-4H2,1-2H3;4-5H,3H2,1-2H3.
What are the key properties of 2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol?
2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol has a molecular weight of 370.48 g/mol, XLogP of 1.02, 13 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butoxyethoxy)ethanol;2-methoxyethyl acetate;1-methoxypropan-2-ol is sourced from PubChem (CID 174793686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).