About 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane
2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane (PubChem CID 87238314) has the molecular formula C14H30O6
and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane.
Molecular Properties
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane |
| PubChem CID | 87238314 |
| Molecular Formula | C14H30O6 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane |
| SMILES | CC(=O)OCCOCCOCCO.CCCOCCC |
| InChI | InChI=1S/C8H16O5.C6H14O/c1-8(10)13-7-6-12-5-4-11-3-2-9;1-3-5-7-6-4-2/h9H,2-7H2,1H3;3-6H2,1-2H3 |
| InChIKey | RLSSXEHXDKCBNV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane?
The IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane (CID 87238314) is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane.
What is the SMILES notation for 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane?
The canonical SMILES for 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane is CC(=O)OCCOCCOCCO.CCCOCCC.
What is the InChIKey of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane?
The InChIKey is RLSSXEHXDKCBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O5.C6H14O/c1-8(10)13-7-6-12-5-4-11-3-2-9;1-3-5-7-6-4-2/h9H,2-7H2,1H3;3-6H2,1-2H3.
What are the key properties of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane?
2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane has a molecular weight of 294.39 g/mol, XLogP of 1.40, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;1-propoxypropane is sourced from PubChem (CID 87238314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).