About 4-hydroxybutyl acetate;1-propoxypropane
4-hydroxybutyl acetate;1-propoxypropane (PubChem CID 87513978) has the molecular formula C12H26O4
and a molecular weight of 234.34 g/mol. Its IUPAC name is 4-hydroxybutyl acetate;1-propoxypropane.
Molecular Properties
| Compound Name | 4-hydroxybutyl acetate;1-propoxypropane |
| PubChem CID | 87513978 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 4-hydroxybutyl acetate;1-propoxypropane |
| SMILES | CC(=O)OCCCCO.CCCOCCC |
| InChI | InChI=1S/C6H12O3.C6H14O/c1-6(8)9-5-3-2-4-7;1-3-5-7-6-4-2/h7H,2-5H2,1H3;3-6H2,1-2H3 |
| InChIKey | ZNYOCQPQGNOFNM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybutyl acetate;1-propoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybutyl acetate;1-propoxypropane?
The IUPAC name of 4-hydroxybutyl acetate;1-propoxypropane (CID 87513978) is 4-hydroxybutyl acetate;1-propoxypropane.
What is the SMILES notation for 4-hydroxybutyl acetate;1-propoxypropane?
The canonical SMILES for 4-hydroxybutyl acetate;1-propoxypropane is CC(=O)OCCCCO.CCCOCCC.
What is the InChIKey of 4-hydroxybutyl acetate;1-propoxypropane?
The InChIKey is ZNYOCQPQGNOFNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C6H14O/c1-6(8)9-5-3-2-4-7;1-3-5-7-6-4-2/h7H,2-5H2,1H3;3-6H2,1-2H3.
What are the key properties of 4-hydroxybutyl acetate;1-propoxypropane?
4-hydroxybutyl acetate;1-propoxypropane has a molecular weight of 234.34 g/mol, XLogP of 2.14, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutyl acetate;1-propoxypropane is sourced from PubChem (CID 87513978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).